C21H19N3O2 — CID 142365403
7-(6-cyclobutyloxy-3-pyridinyl)-5H-pyrido[4,3-b]indole;formaldehyde (PubChem CID 142365403) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is 7-(6-cyclobutyloxy-3-pyridinyl)-5H-pyrido[4,3-b]indole;formaldehyde.
| Compound Name | 7-(6-cyclobutyloxy-3-pyridinyl)-5H-pyrido[4,3-b]indole;formaldehyde |
|---|---|
| PubChem CID | 142365403 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 7-(6-cyclobutyloxy-3-pyridinyl)-5H-pyrido[4,3-b]indole;formaldehyde |
| SMILES | C=O.c1cc2[nH]c3cc(-c4ccc(OC5CCC5)nc4)ccc3c2cn1 |
| InChI | InChI=1S/C20H17N3O.CH2O/c1-2-15(3-1)24-20-7-5-14(11-22-20)13-4-6-16-17-12-21-9-8-18(17)23-19(16)10-13;1-2/h4-12,15,23H,1-3H2;1H2 |
| InChIKey | QSXPJANWFVPRKM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |