methyl 3-(5H-pyrido[4,3-b]indol-8-yl)propanoate

C15H14N2O2 — CID 116985874

IUPACmethyl 3-(5H-pyrido[4,3-b]indol-8-yl)propanoate
SMILESCOC(=O)CCc1ccc2[nH]c3ccncc3c2c1
InChIInChI=1S/C15H14N2O2/c1-19-15(18)5-3-10-2-4-13-11(8-10)12-9-16-7-6-14(12)17-13/h2,4,6-9,17H,3,5H2,1H3
InChIKeyYWPMATSSPFNFRT-UHFFFAOYSA-N
MW254.29 g/mol
LogP2.82
Rot. Bonds3

About methyl 3-(5H-pyrido[4,3-b]indol-8-yl)propanoate

methyl 3-(5H-pyrido[4,3-b]indol-8-yl)propanoate (PubChem CID 116985874) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is methyl 3-(5H-pyrido[4,3-b]indol-8-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-(5H-pyrido[4,3-b]indol-8-yl)propanoate
PubChem CID116985874
Molecular FormulaC15H14N2O2
Molecular Weight254.29 g/mol
Exact Mass254.11
IUPAC Namemethyl 3-(5H-pyrido[4,3-b]indol-8-yl)propanoate
SMILESCOC(=O)CCc1ccc2[nH]c3ccncc3c2c1
InChIInChI=1S/C15H14N2O2/c1-19-15(18)5-3-10-2-4-13-11(8-10)12-9-16-7-6-14(12)17-13/h2,4,6-9,17H,3,5H2,1H3
InChIKeyYWPMATSSPFNFRT-UHFFFAOYSA-N
XLogP2.82
TPSA54.98 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.29
LogP ≤ 52.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 3-(5H-pyrido[4,3-b]indol-8-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(5H-pyrido[4,3-b]indol-8-yl)propanoate?
The IUPAC name of methyl 3-(5H-pyrido[4,3-b]indol-8-yl)propanoate (CID 116985874) is methyl 3-(5H-pyrido[4,3-b]indol-8-yl)propanoate.
What is the SMILES notation for methyl 3-(5H-pyrido[4,3-b]indol-8-yl)propanoate?
The canonical SMILES for methyl 3-(5H-pyrido[4,3-b]indol-8-yl)propanoate is COC(=O)CCc1ccc2[nH]c3ccncc3c2c1.
What is the InChIKey of methyl 3-(5H-pyrido[4,3-b]indol-8-yl)propanoate?
The InChIKey is YWPMATSSPFNFRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O2/c1-19-15(18)5-3-10-2-4-13-11(8-10)12-9-16-7-6-14(12)17-13/h2,4,6-9,17H,3,5H2,1H3.
What are the key properties of methyl 3-(5H-pyrido[4,3-b]indol-8-yl)propanoate?
methyl 3-(5H-pyrido[4,3-b]indol-8-yl)propanoate has a molecular weight of 254.29 g/mol, XLogP of 2.82, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(5H-pyrido[4,3-b]indol-8-yl)propanoate is sourced from PubChem (CID 116985874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).