C14H13N3O2 — CID 116985921
2-(methylamino)-2-(5H-pyrido[4,3-b]indol-8-yl)acetic acid (PubChem CID 116985921) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-(methylamino)-2-(5H-pyrido[4,3-b]indol-8-yl)acetic acid.
| Compound Name | 2-(methylamino)-2-(5H-pyrido[4,3-b]indol-8-yl)acetic acid |
|---|---|
| PubChem CID | 116985921 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-(methylamino)-2-(5H-pyrido[4,3-b]indol-8-yl)acetic acid |
| SMILES | CNC(C(=O)O)c1ccc2[nH]c3ccncc3c2c1 |
| InChI | InChI=1S/C14H13N3O2/c1-15-13(14(18)19)8-2-3-11-9(6-8)10-7-16-5-4-12(10)17-11/h2-7,13,15,17H,1H3,(H,18,19) |
| InChIKey | QUIBPOCLRXPZIM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |