C18H15N3O2S — CID 52946231
4-methyl-N-(5H-pyrido[4,3-b]indol-8-yl)benzenesulfonamide (PubChem CID 52946231) has the molecular formula C18H15N3O2S and a molecular weight of 337.40 g/mol. Its IUPAC name is 4-methyl-N-(5H-pyrido[4,3-b]indol-8-yl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(5H-pyrido[4,3-b]indol-8-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 52946231 |
| Molecular Formula | C18H15N3O2S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 4-methyl-N-(5H-pyrido[4,3-b]indol-8-yl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc3[nH]c4ccncc4c3c2)cc1 |
| InChI | InChI=1S/C18H15N3O2S/c1-12-2-5-14(6-3-12)24(22,23)21-13-4-7-17-15(10-13)16-11-19-9-8-18(16)20-17/h2-11,20-21H,1H3 |
| InChIKey | OFYTUPQZGDDYTL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |