C20H19N3O2S — CID 52941468
2,4,6-trimethyl-N-(5H-pyrido[4,3-b]indol-8-yl)benzenesulfonamide (PubChem CID 52941468) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-(5H-pyrido[4,3-b]indol-8-yl)benzenesulfonamide.
| Compound Name | 2,4,6-trimethyl-N-(5H-pyrido[4,3-b]indol-8-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 52941468 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 2,4,6-trimethyl-N-(5H-pyrido[4,3-b]indol-8-yl)benzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)Nc2ccc3[nH]c4ccncc4c3c2)c(C)c1 |
| InChI | InChI=1S/C20H19N3O2S/c1-12-8-13(2)20(14(3)9-12)26(24,25)23-15-4-5-18-16(10-15)17-11-21-7-6-19(17)22-18/h4-11,22-23H,1-3H3 |
| InChIKey | WGDHSTSMUHBVMW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |