C16H19NO3S — CID 64795077
N-[4-(hydroxymethyl)phenyl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 64795077) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-[4-(hydroxymethyl)phenyl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[4-(hydroxymethyl)phenyl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 64795077 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | N-[4-(hydroxymethyl)phenyl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)Nc2ccc(CO)cc2)c(C)c1 |
| InChI | InChI=1S/C16H19NO3S/c1-11-8-12(2)16(13(3)9-11)21(19,20)17-15-6-4-14(10-18)5-7-15/h4-9,17-18H,10H2,1-3H3 |
| InChIKey | ZDMBUZDQBDRISA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |