C20H26N2O3S — CID 24663110
N-tert-butyl-4-[(2,4,6-trimethylphenyl)sulfonylamino]benzamide (PubChem CID 24663110) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is N-tert-butyl-4-[(2,4,6-trimethylphenyl)sulfonylamino]benzamide.
| Compound Name | N-tert-butyl-4-[(2,4,6-trimethylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 24663110 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N-tert-butyl-4-[(2,4,6-trimethylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)Nc2ccc(C(=O)NC(C)(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C20H26N2O3S/c1-13-11-14(2)18(15(3)12-13)26(24,25)22-17-9-7-16(8-10-17)19(23)21-20(4,5)6/h7-12,22H,1-6H3,(H,21,23) |
| InChIKey | XGDKCGAJLKZJSI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |