C23H22N2O2S — CID 46331635
N-[4-(1H-indol-2-yl)phenyl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 46331635) has the molecular formula C23H22N2O2S and a molecular weight of 390.51 g/mol. Its IUPAC name is N-[4-(1H-indol-2-yl)phenyl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[4-(1H-indol-2-yl)phenyl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 46331635 |
| Molecular Formula | C23H22N2O2S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-[4-(1H-indol-2-yl)phenyl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)Nc2ccc(-c3cc4ccccc4[nH]3)cc2)c(C)c1 |
| InChI | InChI=1S/C23H22N2O2S/c1-15-12-16(2)23(17(3)13-15)28(26,27)25-20-10-8-18(9-11-20)22-14-19-6-4-5-7-21(19)24-22/h4-14,24-25H,1-3H3 |
| InChIKey | CUAZDXVGPCXTPS-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |