C24H22N2O2S — CID 46331649
N-[4-(1H-indol-2-yl)phenyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide (PubChem CID 46331649) has the molecular formula C24H22N2O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is N-[4-(1H-indol-2-yl)phenyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide.
| Compound Name | N-[4-(1H-indol-2-yl)phenyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 46331649 |
| Molecular Formula | C24H22N2O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-[4-(1H-indol-2-yl)phenyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-c2cc3ccccc3[nH]2)cc1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C24H22N2O2S/c27-29(28,22-14-11-17-5-1-2-6-19(17)15-22)26-21-12-9-18(10-13-21)24-16-20-7-3-4-8-23(20)25-24/h3-4,7-16,25-26H,1-2,5-6H2 |
| InChIKey | XGGNHGGUNLEZEY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |