C10H9N3O4 — CID 176610283
methyl 2-(2,4-dioxo-1H-pyrido[4,3-d]pyrimidin-3-yl)acetate (PubChem CID 176610283) has the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. Its IUPAC name is methyl 2-(2,4-dioxo-1H-pyrido[4,3-d]pyrimidin-3-yl)acetate.
| Compound Name | methyl 2-(2,4-dioxo-1H-pyrido[4,3-d]pyrimidin-3-yl)acetate |
|---|---|
| PubChem CID | 176610283 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | methyl 2-(2,4-dioxo-1H-pyrido[4,3-d]pyrimidin-3-yl)acetate |
| SMILES | COC(=O)Cn1c(=O)[nH]c2ccncc2c1=O |
| InChI | InChI=1S/C10H9N3O4/c1-17-8(14)5-13-9(15)6-4-11-3-2-7(6)12-10(13)16/h2-4H,5H2,1H3,(H,12,16) |
| InChIKey | BHHKSJHLZLRFEO-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |