C15H14N2O — CID 142517237
4-(5H-pyrido[4,3-b]indol-7-yl)but-1-en-2-ol (PubChem CID 142517237) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 4-(5H-pyrido[4,3-b]indol-7-yl)but-1-en-2-ol.
| Compound Name | 4-(5H-pyrido[4,3-b]indol-7-yl)but-1-en-2-ol |
|---|---|
| PubChem CID | 142517237 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 4-(5H-pyrido[4,3-b]indol-7-yl)but-1-en-2-ol |
| SMILES | C=C(O)CCc1ccc2c(c1)[nH]c1ccncc12 |
| InChI | InChI=1S/C15H14N2O/c1-10(18)2-3-11-4-5-12-13-9-16-7-6-14(13)17-15(12)8-11/h4-9,17-18H,1-3H2 |
| InChIKey | KDJOBJZEKNJSQJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|