C16H17N3O — CID 116986104
2-(5H-pyrido[4,3-b]indol-7-ylmethyl)morpholine (PubChem CID 116986104) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-(5H-pyrido[4,3-b]indol-7-ylmethyl)morpholine.
| Compound Name | 2-(5H-pyrido[4,3-b]indol-7-ylmethyl)morpholine |
|---|---|
| PubChem CID | 116986104 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-(5H-pyrido[4,3-b]indol-7-ylmethyl)morpholine |
| SMILES | c1cc2[nH]c3cc(CC4CNCCO4)ccc3c2cn1 |
| InChI | InChI=1S/C16H17N3O/c1-2-13-14-10-17-4-3-15(14)19-16(13)8-11(1)7-12-9-18-5-6-20-12/h1-4,8,10,12,18-19H,5-7,9H2 |
| InChIKey | LZJYRODOTQOENB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |