C16H23N5O3 — CID 140550122
3-[3-(3-amino-1,2,4-triazol-1-yl)phenoxy]propyl N-tert-butylcarbamate (PubChem CID 140550122) has the molecular formula C16H23N5O3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 3-[3-(3-amino-1,2,4-triazol-1-yl)phenoxy]propyl N-tert-butylcarbamate.
| Compound Name | 3-[3-(3-amino-1,2,4-triazol-1-yl)phenoxy]propyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 140550122 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 3-[3-(3-amino-1,2,4-triazol-1-yl)phenoxy]propyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCCCOc1cccc(-n2cnc(N)n2)c1 |
| InChI | InChI=1S/C16H23N5O3/c1-16(2,3)19-15(22)24-9-5-8-23-13-7-4-6-12(10-13)21-11-18-14(17)20-21/h4,6-7,10-11H,5,8-9H2,1-3H3,(H2,17,20)(H,19,22) |
| InChIKey | APZPOPAMHNMYEK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|