C19H17N3O — CID 135060180
N-[(4-methoxyphenyl)methyl]-9H-pyrido[2,3-b]indol-4-amine (PubChem CID 135060180) has the molecular formula C19H17N3O and a molecular weight of 303.37 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-9H-pyrido[2,3-b]indol-4-amine.
| Compound Name | N-[(4-methoxyphenyl)methyl]-9H-pyrido[2,3-b]indol-4-amine |
|---|---|
| PubChem CID | 135060180 |
| Molecular Formula | C19H17N3O |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-9H-pyrido[2,3-b]indol-4-amine |
| SMILES | COc1ccc(CNc2ccnc3[nH]c4ccccc4c23)cc1 |
| InChI | InChI=1S/C19H17N3O/c1-23-14-8-6-13(7-9-14)12-21-17-10-11-20-19-18(17)15-4-2-3-5-16(15)22-19/h2-11H,12H2,1H3,(H2,20,21,22) |
| InChIKey | NATMIONKAXKNHT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |