C8H8IN3O — CID 139502494
2-iodo-4-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 139502494) has the molecular formula C8H8IN3O and a molecular weight of 289.08 g/mol. Its IUPAC name is 2-iodo-4-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-iodo-4-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 139502494 |
| Molecular Formula | C8H8IN3O |
| Molecular Weight | 289.08 g/mol |
| Exact Mass | 288.97 |
| IUPAC Name | 2-iodo-4-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1nc(I)nc2c1CCC(=O)N2 |
| InChI | InChI=1S/C8H8IN3O/c1-4-5-2-3-6(13)11-7(5)12-8(9)10-4/h2-3H2,1H3,(H,10,11,12,13) |
| InChIKey | KQJDBZBPADWRCX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.08 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|