C19H17N3O3 — CID 123536143
ethane;5-quinolin-5-yloxy-1,4-dihydro-1,8-naphthyridine-2,3-dione (PubChem CID 123536143) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is ethane;5-quinolin-5-yloxy-1,4-dihydro-1,8-naphthyridine-2,3-dione.
| Compound Name | ethane;5-quinolin-5-yloxy-1,4-dihydro-1,8-naphthyridine-2,3-dione |
|---|---|
| PubChem CID | 123536143 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | ethane;5-quinolin-5-yloxy-1,4-dihydro-1,8-naphthyridine-2,3-dione |
| SMILES | CC.O=C1Cc2c(Oc3cccc4ncccc34)ccnc2NC1=O |
| InChI | InChI=1S/C17H11N3O3.C2H6/c21-13-9-11-15(6-8-19-16(11)20-17(13)22)23-14-5-1-4-12-10(14)3-2-7-18-12;1-2/h1-8H,9H2,(H,19,20,22);1-2H3 |
| InChIKey | RAYZMCMUHNOLIZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|