C15H16N5OP — CID 70964342
4-[8-(methylphosphanylamino)quinolin-5-yl]oxypyridine-2,3-diamine (PubChem CID 70964342) has the molecular formula C15H16N5OP and a molecular weight of 313.30 g/mol. Its IUPAC name is 4-[8-(methylphosphanylamino)quinolin-5-yl]oxypyridine-2,3-diamine.
| Compound Name | 4-[8-(methylphosphanylamino)quinolin-5-yl]oxypyridine-2,3-diamine |
|---|---|
| PubChem CID | 70964342 |
| Molecular Formula | C15H16N5OP |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 4-[8-(methylphosphanylamino)quinolin-5-yl]oxypyridine-2,3-diamine |
| SMILES | CPNc1ccc(Oc2ccnc(N)c2N)c2cccnc12 |
| InChI | InChI=1S/C15H16N5OP/c1-22-20-10-4-5-11(9-3-2-7-18-14(9)10)21-12-6-8-19-15(17)13(12)16/h2-8,20,22H,16H2,1H3,(H2,17,19) |
| InChIKey | WBTZWLHUXMWRBY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|