C16H16N6O3S — CID 143881449
N-[3-(methylamino)-4-[8-(sulfinamoylamino)quinolin-5-yl]oxy-2-pyridinyl]formamide (PubChem CID 143881449) has the molecular formula C16H16N6O3S and a molecular weight of 372.41 g/mol. Its IUPAC name is N-[3-(methylamino)-4-[8-(sulfinamoylamino)quinolin-5-yl]oxy-2-pyridinyl]formamide.
| Compound Name | N-[3-(methylamino)-4-[8-(sulfinamoylamino)quinolin-5-yl]oxy-2-pyridinyl]formamide |
|---|---|
| PubChem CID | 143881449 |
| Molecular Formula | C16H16N6O3S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-[3-(methylamino)-4-[8-(sulfinamoylamino)quinolin-5-yl]oxy-2-pyridinyl]formamide |
| SMILES | CNc1c(Oc2ccc(NS(N)=O)c3ncccc23)ccnc1NC=O |
| InChI | InChI=1S/C16H16N6O3S/c1-18-15-13(6-8-20-16(15)21-9-23)25-12-5-4-11(22-26(17)24)14-10(12)3-2-7-19-14/h2-9,18,22H,17H2,1H3,(H,20,21,23) |
| InChIKey | VQUFKBDLCIZVET-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|