C15H14N4O — CID 141279533
4-(3-aminophenoxy)-N-methyl-1,7-naphthyridin-8-amine (PubChem CID 141279533) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-(3-aminophenoxy)-N-methyl-1,7-naphthyridin-8-amine.
| Compound Name | 4-(3-aminophenoxy)-N-methyl-1,7-naphthyridin-8-amine |
|---|---|
| PubChem CID | 141279533 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 4-(3-aminophenoxy)-N-methyl-1,7-naphthyridin-8-amine |
| SMILES | CNc1nccc2c(Oc3cccc(N)c3)ccnc12 |
| InChI | InChI=1S/C15H14N4O/c1-17-15-14-12(5-7-19-15)13(6-8-18-14)20-11-4-2-3-10(16)9-11/h2-9H,16H2,1H3,(H,17,19) |
| InChIKey | PPQFKBWWBYKTNB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|