C22H17N5O — CID 90004941
N-[4-(4-aminonaphthalen-1-yl)oxypyrimidin-2-yl]-1H-indol-5-amine (PubChem CID 90004941) has the molecular formula C22H17N5O and a molecular weight of 367.41 g/mol. Its IUPAC name is N-[4-(4-aminonaphthalen-1-yl)oxypyrimidin-2-yl]-1H-indol-5-amine.
| Compound Name | N-[4-(4-aminonaphthalen-1-yl)oxypyrimidin-2-yl]-1H-indol-5-amine |
|---|---|
| PubChem CID | 90004941 |
| Molecular Formula | C22H17N5O |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-[4-(4-aminonaphthalen-1-yl)oxypyrimidin-2-yl]-1H-indol-5-amine |
| SMILES | Nc1ccc(Oc2ccnc(Nc3ccc4[nH]ccc4c3)n2)c2ccccc12 |
| InChI | InChI=1S/C22H17N5O/c23-18-6-8-20(17-4-2-1-3-16(17)18)28-21-10-12-25-22(27-21)26-15-5-7-19-14(13-15)9-11-24-19/h1-13,24H,23H2,(H,25,26,27) |
| InChIKey | WHYXZLDGXOAPBA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|