C24H21N7O2 — CID 90004967
5-[[4-(4-aminonaphthalen-1-yl)oxypyrimidin-2-yl]amino]-N,N-dimethyl-1H-indazole-3-carboxamide (PubChem CID 90004967) has the molecular formula C24H21N7O2 and a molecular weight of 439.48 g/mol. Its IUPAC name is 5-[[4-(4-aminonaphthalen-1-yl)oxypyrimidin-2-yl]amino]-N,N-dimethyl-1H-indazole-3-carboxamide.
| Compound Name | 5-[[4-(4-aminonaphthalen-1-yl)oxypyrimidin-2-yl]amino]-N,N-dimethyl-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 90004967 |
| Molecular Formula | C24H21N7O2 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 5-[[4-(4-aminonaphthalen-1-yl)oxypyrimidin-2-yl]amino]-N,N-dimethyl-1H-indazole-3-carboxamide |
| SMILES | CN(C)C(=O)c1n[nH]c2ccc(Nc3nccc(Oc4ccc(N)c5ccccc45)n3)cc12 |
| InChI | InChI=1S/C24H21N7O2/c1-31(2)23(32)22-17-13-14(7-9-19(17)29-30-22)27-24-26-12-11-21(28-24)33-20-10-8-18(25)15-5-3-4-6-16(15)20/h3-13H,25H2,1-2H3,(H,29,30)(H,26,27,28) |
| InChIKey | ACOBFJHGLGKMQK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|