C24H23N5O4 — CID 90039428
3-[[4-(4-aminonaphthalen-1-yl)oxypyrimidin-2-yl]amino]-4-(3-hydroxypropoxy)benzamide (PubChem CID 90039428) has the molecular formula C24H23N5O4 and a molecular weight of 445.48 g/mol. Its IUPAC name is 3-[[4-(4-aminonaphthalen-1-yl)oxypyrimidin-2-yl]amino]-4-(3-hydroxypropoxy)benzamide.
| Compound Name | 3-[[4-(4-aminonaphthalen-1-yl)oxypyrimidin-2-yl]amino]-4-(3-hydroxypropoxy)benzamide |
|---|---|
| PubChem CID | 90039428 |
| Molecular Formula | C24H23N5O4 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 3-[[4-(4-aminonaphthalen-1-yl)oxypyrimidin-2-yl]amino]-4-(3-hydroxypropoxy)benzamide |
| SMILES | NC(=O)c1ccc(OCCCO)c(Nc2nccc(Oc3ccc(N)c4ccccc34)n2)c1 |
| InChI | InChI=1S/C24H23N5O4/c25-18-7-9-20(17-5-2-1-4-16(17)18)33-22-10-11-27-24(29-22)28-19-14-15(23(26)31)6-8-21(19)32-13-3-12-30/h1-2,4-11,14,30H,3,12-13,25H2,(H2,26,31)(H,27,28,29) |
| InChIKey | LEGVRCRSFLTQRH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|