C22H18N6O — CID 118235979
N-[4-(4-aminonaphthalen-1-yl)oxypyrimidin-2-yl]-6-methyl-1H-indazol-5-amine (PubChem CID 118235979) has the molecular formula C22H18N6O and a molecular weight of 382.43 g/mol. Its IUPAC name is N-[4-(4-aminonaphthalen-1-yl)oxypyrimidin-2-yl]-6-methyl-1H-indazol-5-amine.
| Compound Name | N-[4-(4-aminonaphthalen-1-yl)oxypyrimidin-2-yl]-6-methyl-1H-indazol-5-amine |
|---|---|
| PubChem CID | 118235979 |
| Molecular Formula | C22H18N6O |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-[4-(4-aminonaphthalen-1-yl)oxypyrimidin-2-yl]-6-methyl-1H-indazol-5-amine |
| SMILES | Cc1cc2[nH]ncc2cc1Nc1nccc(Oc2ccc(N)c3ccccc23)n1 |
| InChI | InChI=1S/C22H18N6O/c1-13-10-19-14(12-25-28-19)11-18(13)26-22-24-9-8-21(27-22)29-20-7-6-17(23)15-4-2-3-5-16(15)20/h2-12H,23H2,1H3,(H,25,28)(H,24,26,27) |
| InChIKey | CGKSWZZSLWZTJJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|