C16H12F2N4O — CID 59852945
4-(4-amino-2-fluorophenoxy)-N-(4-fluorophenyl)pyrimidin-2-amine (PubChem CID 59852945) has the molecular formula C16H12F2N4O and a molecular weight of 314.30 g/mol. Its IUPAC name is 4-(4-amino-2-fluorophenoxy)-N-(4-fluorophenyl)pyrimidin-2-amine.
| Compound Name | 4-(4-amino-2-fluorophenoxy)-N-(4-fluorophenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 59852945 |
| Molecular Formula | C16H12F2N4O |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 4-(4-amino-2-fluorophenoxy)-N-(4-fluorophenyl)pyrimidin-2-amine |
| SMILES | Nc1ccc(Oc2ccnc(Nc3ccc(F)cc3)n2)c(F)c1 |
| InChI | InChI=1S/C16H12F2N4O/c17-10-1-4-12(5-2-10)21-16-20-8-7-15(22-16)23-14-6-3-11(19)9-13(14)18/h1-9H,19H2,(H,20,21,22) |
| InChIKey | YNCXREUGOOEKDG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|