C20H19FN4O — CID 56575580
4-(4-fluorophenoxy)-N-(4-pyrrolidin-1-ylphenyl)pyrimidin-2-amine (PubChem CID 56575580) has the molecular formula C20H19FN4O and a molecular weight of 350.40 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-N-(4-pyrrolidin-1-ylphenyl)pyrimidin-2-amine.
| Compound Name | 4-(4-fluorophenoxy)-N-(4-pyrrolidin-1-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 56575580 |
| Molecular Formula | C20H19FN4O |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 4-(4-fluorophenoxy)-N-(4-pyrrolidin-1-ylphenyl)pyrimidin-2-amine |
| SMILES | Fc1ccc(Oc2ccnc(Nc3ccc(N4CCCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C20H19FN4O/c21-15-3-9-18(10-4-15)26-19-11-12-22-20(24-19)23-16-5-7-17(8-6-16)25-13-1-2-14-25/h3-12H,1-2,13-14H2,(H,22,23,24) |
| InChIKey | ZKCBFOWEKLKWGD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|