C21H20F2N4O — CID 56574268
4-(4-fluorophenoxy)-N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]pyrimidin-2-amine (PubChem CID 56574268) has the molecular formula C21H20F2N4O and a molecular weight of 382.41 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]pyrimidin-2-amine.
| Compound Name | 4-(4-fluorophenoxy)-N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 56574268 |
| Molecular Formula | C21H20F2N4O |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 4-(4-fluorophenoxy)-N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]pyrimidin-2-amine |
| SMILES | Fc1ccc(Oc2ccnc(NCC3CCN(c4ccc(F)cc4)C3)n2)cc1 |
| InChI | InChI=1S/C21H20F2N4O/c22-16-1-5-18(6-2-16)27-12-10-15(14-27)13-25-21-24-11-9-20(26-21)28-19-7-3-17(23)4-8-19/h1-9,11,15H,10,12-14H2,(H,24,25,26) |
| InChIKey | WAFNSXCLJJNSJI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |