C21H21FN4O4S — CID 56575792
4-(4-fluorophenoxy)-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]pyrimidin-2-amine (PubChem CID 56575792) has the molecular formula C21H21FN4O4S and a molecular weight of 444.49 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]pyrimidin-2-amine.
| Compound Name | 4-(4-fluorophenoxy)-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 56575792 |
| Molecular Formula | C21H21FN4O4S |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 4-(4-fluorophenoxy)-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]pyrimidin-2-amine |
| SMILES | O=S(=O)(c1ccc(CNc2nccc(Oc3ccc(F)cc3)n2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C21H21FN4O4S/c22-17-3-5-18(6-4-17)30-20-9-10-23-21(25-20)24-15-16-1-7-19(8-2-16)31(27,28)26-11-13-29-14-12-26/h1-10H,11-15H2,(H,23,24,25) |
| InChIKey | QKXIVEKNQLENQR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |