C17H17FN4 — CID 125142211
2-[[(3R)-1-(4-fluorophenyl)pyrrolidin-3-yl]methylamino]pyridine-4-carbonitrile (PubChem CID 125142211) has the molecular formula C17H17FN4 and a molecular weight of 296.35 g/mol. Its IUPAC name is 2-[[(3R)-1-(4-fluorophenyl)pyrrolidin-3-yl]methylamino]pyridine-4-carbonitrile.
| Compound Name | 2-[[(3R)-1-(4-fluorophenyl)pyrrolidin-3-yl]methylamino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 125142211 |
| Molecular Formula | C17H17FN4 |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-[[(3R)-1-(4-fluorophenyl)pyrrolidin-3-yl]methylamino]pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(NC[C@H]2CCN(c3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C17H17FN4/c18-15-1-3-16(4-2-15)22-8-6-14(12-22)11-21-17-9-13(10-19)5-7-20-17/h1-5,7,9,14H,6,8,11-12H2,(H,20,21)/t14-/m1/s1 |
| InChIKey | KRBVNDJREUIMEA-CQSZACIVSA-N |
| XLogP | 3.03 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |