About 2-cyclopropyl-N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]pyrimidin-4-amine
2-cyclopropyl-N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]pyrimidin-4-amine (PubChem CID 133299085) has the molecular formula C18H20F2N4
and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-cyclopropyl-N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-cyclopropyl-N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]pyrimidin-4-amine |
| PubChem CID | 133299085 |
| Molecular Formula | C18H20F2N4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2-cyclopropyl-N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]pyrimidin-4-amine |
| SMILES | Fc1ccc(N2CCC(CNc3ccnc(C4CC4)n3)C2)cc1F |
| InChI | InChI=1S/C18H20F2N4/c19-15-4-3-14(9-16(15)20)24-8-6-12(11-24)10-22-17-5-7-21-18(23-17)13-1-2-13/h3-5,7,9,12-13H,1-2,6,8,10-11H2,(H,21,22,23) |
| InChIKey | SAPSNBJCQJIVCA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclopropyl-N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]pyrimidin-4-amine?
The IUPAC name of 2-cyclopropyl-N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]pyrimidin-4-amine (CID 133299085) is 2-cyclopropyl-N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]pyrimidin-4-amine.
What is the SMILES notation for 2-cyclopropyl-N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]pyrimidin-4-amine?
The canonical SMILES for 2-cyclopropyl-N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]pyrimidin-4-amine is Fc1ccc(N2CCC(CNc3ccnc(C4CC4)n3)C2)cc1F.
What is the InChIKey of 2-cyclopropyl-N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]pyrimidin-4-amine?
The InChIKey is SAPSNBJCQJIVCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20F2N4/c19-15-4-3-14(9-16(15)20)24-8-6-12(11-24)10-22-17-5-7-21-18(23-17)13-1-2-13/h3-5,7,9,12-13H,1-2,6,8,10-11H2,(H,21,22,23).
What are the key properties of 2-cyclopropyl-N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]pyrimidin-4-amine?
2-cyclopropyl-N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]pyrimidin-4-amine has a molecular weight of 330.38 g/mol, XLogP of 3.57, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]pyrimidin-4-amine is sourced from PubChem (CID 133299085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).