About (1R)-N-[[(3S)-1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-pyridin-3-ylethanamine
(1R)-N-[[(3S)-1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-pyridin-3-ylethanamine (PubChem CID 97158257) has the molecular formula C18H21F2N3
and a molecular weight of 317.38 g/mol. Its IUPAC name is (1R)-N-[[(3S)-1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-pyridin-3-ylethanamine.
Molecular Properties
| Compound Name | (1R)-N-[[(3S)-1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-pyridin-3-ylethanamine |
| PubChem CID | 97158257 |
| Molecular Formula | C18H21F2N3 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (1R)-N-[[(3S)-1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-pyridin-3-ylethanamine |
| SMILES | C[C@@H](NC[C@@H]1CCN(c2ccc(F)c(F)c2)C1)c1cccnc1 |
| InChI | InChI=1S/C18H21F2N3/c1-13(15-3-2-7-21-11-15)22-10-14-6-8-23(12-14)16-4-5-17(19)18(20)9-16/h2-5,7,9,11,13-14,22H,6,8,10,12H2,1H3/t13-,14+/m1/s1 |
| InChIKey | IOZJKFFQOXQYPD-KGLIPLIRSA-N |
| XLogP | 3.54 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-N-[[(3S)-1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-pyridin-3-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-N-[[(3S)-1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-pyridin-3-ylethanamine?
The IUPAC name of (1R)-N-[[(3S)-1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-pyridin-3-ylethanamine (CID 97158257) is (1R)-N-[[(3S)-1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-pyridin-3-ylethanamine.
What is the SMILES notation for (1R)-N-[[(3S)-1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-pyridin-3-ylethanamine?
The canonical SMILES for (1R)-N-[[(3S)-1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-pyridin-3-ylethanamine is C[C@@H](NC[C@@H]1CCN(c2ccc(F)c(F)c2)C1)c1cccnc1.
What is the InChIKey of (1R)-N-[[(3S)-1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-pyridin-3-ylethanamine?
The InChIKey is IOZJKFFQOXQYPD-KGLIPLIRSA-N. The full InChI is InChI=1S/C18H21F2N3/c1-13(15-3-2-7-21-11-15)22-10-14-6-8-23(12-14)16-4-5-17(19)18(20)9-16/h2-5,7,9,11,13-14,22H,6,8,10,12H2,1H3/t13-,14+/m1/s1.
What are the key properties of (1R)-N-[[(3S)-1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-pyridin-3-ylethanamine?
(1R)-N-[[(3S)-1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-pyridin-3-ylethanamine has a molecular weight of 317.38 g/mol, XLogP of 3.54, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-N-[[(3S)-1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-pyridin-3-ylethanamine is sourced from PubChem (CID 97158257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).