C19H22ClFN2 — CID 25265632
(1R)-1-(3-chlorophenyl)-N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]ethanamine (PubChem CID 25265632) has the molecular formula C19H22ClFN2 and a molecular weight of 332.85 g/mol. Its IUPAC name is (1R)-1-(3-chlorophenyl)-N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]ethanamine.
| Compound Name | (1R)-1-(3-chlorophenyl)-N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 25265632 |
| Molecular Formula | C19H22ClFN2 |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (1R)-1-(3-chlorophenyl)-N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]ethanamine |
| SMILES | C[C@@H](NCC1CCN(c2ccc(F)cc2)C1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H22ClFN2/c1-14(16-3-2-4-17(20)11-16)22-12-15-9-10-23(13-15)19-7-5-18(21)6-8-19/h2-8,11,14-15,22H,9-10,12-13H2,1H3/t14-,15?/m1/s1 |
| InChIKey | PIOMUHHKNVDAOX-GICMACPYSA-N |
| XLogP | 4.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |