C19H29F2IN4 — CID 110957395
1-cyclohexyl-3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 110957395) has the molecular formula C19H29F2IN4 and a molecular weight of 478.37 g/mol. Its IUPAC name is 1-cyclohexyl-3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-cyclohexyl-3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110957395 |
| Molecular Formula | C19H29F2IN4 |
| Molecular Weight | 478.37 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 1-cyclohexyl-3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCN(c2ccc(F)c(F)c2)C1)NC1CCCCC1.I |
| InChI | InChI=1S/C19H28F2N4.HI/c1-22-19(24-15-5-3-2-4-6-15)23-12-14-9-10-25(13-14)16-7-8-17(20)18(21)11-16;/h7-8,11,14-15H,2-6,9-10,12-13H2,1H3,(H2,22,23,24);1H |
| InChIKey | BGZJCKVTWHIDPV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|