C25H33F2N5 — CID 110985780
1-(1-benzylpiperidin-4-yl)-3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-2-methylguanidine (PubChem CID 110985780) has the molecular formula C25H33F2N5 and a molecular weight of 441.57 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-2-methylguanidine.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110985780 |
| Molecular Formula | C25H33F2N5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCC1CCN(c2ccc(F)c(F)c2)C1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H33F2N5/c1-28-25(30-21-10-12-31(13-11-21)17-19-5-3-2-4-6-19)29-16-20-9-14-32(18-20)22-7-8-23(26)24(27)15-22/h2-8,15,20-21H,9-14,16-18H2,1H3,(H2,28,29,30) |
| InChIKey | BZMJNBRNKODQCH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|