C24H31FN4O — CID 95144958
1-(1-benzylpiperidin-4-yl)-3-[[(3S)-1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]urea (PubChem CID 95144958) has the molecular formula C24H31FN4O and a molecular weight of 410.54 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-[[(3S)-1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]urea.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-[[(3S)-1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 95144958 |
| Molecular Formula | C24H31FN4O |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-[[(3S)-1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]urea |
| SMILES | O=C(NC[C@@H]1CCN(c2ccc(F)cc2)C1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H31FN4O/c25-21-6-8-23(9-7-21)29-15-10-20(18-29)16-26-24(30)27-22-11-13-28(14-12-22)17-19-4-2-1-3-5-19/h1-9,20,22H,10-18H2,(H2,26,27,30)/t20-/m0/s1 |
| InChIKey | ABYQXIBGBCPSGL-FQEVSTJZSA-N |
| XLogP | 3.62 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |