C23H29FN4O — CID 94382188
2-[4-(4-fluorophenyl)piperazin-1-yl]-N-[[(3R)-1-phenylpyrrolidin-3-yl]methyl]acetamide (PubChem CID 94382188) has the molecular formula C23H29FN4O and a molecular weight of 396.51 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)piperazin-1-yl]-N-[[(3R)-1-phenylpyrrolidin-3-yl]methyl]acetamide.
| Compound Name | 2-[4-(4-fluorophenyl)piperazin-1-yl]-N-[[(3R)-1-phenylpyrrolidin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 94382188 |
| Molecular Formula | C23H29FN4O |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 2-[4-(4-fluorophenyl)piperazin-1-yl]-N-[[(3R)-1-phenylpyrrolidin-3-yl]methyl]acetamide |
| SMILES | O=C(CN1CCN(c2ccc(F)cc2)CC1)NC[C@H]1CCN(c2ccccc2)C1 |
| InChI | InChI=1S/C23H29FN4O/c24-20-6-8-22(9-7-20)27-14-12-26(13-15-27)18-23(29)25-16-19-10-11-28(17-19)21-4-2-1-3-5-21/h1-9,19H,10-18H2,(H,25,29)/t19-/m1/s1 |
| InChIKey | CXDONQBZRIOKBC-LJQANCHMSA-N |
| XLogP | 2.59 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |