C24H32N4O3S — CID 55832362
2-(4-benzylsulfonylpiperazin-1-yl)-N-[(1-phenylpyrrolidin-3-yl)methyl]acetamide (PubChem CID 55832362) has the molecular formula C24H32N4O3S and a molecular weight of 456.61 g/mol. Its IUPAC name is 2-(4-benzylsulfonylpiperazin-1-yl)-N-[(1-phenylpyrrolidin-3-yl)methyl]acetamide.
| Compound Name | 2-(4-benzylsulfonylpiperazin-1-yl)-N-[(1-phenylpyrrolidin-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 55832362 |
| Molecular Formula | C24H32N4O3S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 2-(4-benzylsulfonylpiperazin-1-yl)-N-[(1-phenylpyrrolidin-3-yl)methyl]acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)Cc2ccccc2)CC1)NCC1CCN(c2ccccc2)C1 |
| InChI | InChI=1S/C24H32N4O3S/c29-24(25-17-22-11-12-27(18-22)23-9-5-2-6-10-23)19-26-13-15-28(16-14-26)32(30,31)20-21-7-3-1-4-8-21/h1-10,22H,11-20H2,(H,25,29) |
| InChIKey | XNVWEZZAULTOKI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |