C23H26N6O4 — CID 23536381
2-N-[3,4-bis(2-methoxyethoxy)phenyl]-4-N-(1H-indol-5-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 23536381) has the molecular formula C23H26N6O4 and a molecular weight of 450.50 g/mol. Its IUPAC name is 2-N-[3,4-bis(2-methoxyethoxy)phenyl]-4-N-(1H-indol-5-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[3,4-bis(2-methoxyethoxy)phenyl]-4-N-(1H-indol-5-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23536381 |
| Molecular Formula | C23H26N6O4 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 2-N-[3,4-bis(2-methoxyethoxy)phenyl]-4-N-(1H-indol-5-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | COCCOc1ccc(Nc2ncnc(Nc3ccc4[nH]ccc4c3)n2)cc1OCCOC |
| InChI | InChI=1S/C23H26N6O4/c1-30-9-11-32-20-6-4-18(14-21(20)33-12-10-31-2)28-23-26-15-25-22(29-23)27-17-3-5-19-16(13-17)7-8-24-19/h3-8,13-15,24H,9-12H2,1-2H3,(H2,25,26,27,28,29) |
| InChIKey | GVCUUNYIBKMLAA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|