C36H48N6O9 — CID 23527673
2-N,4-N,6-N-tris[3-(2-ethoxyethoxy)-4-methoxyphenyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 23527673) has the molecular formula C36H48N6O9 and a molecular weight of 708.81 g/mol. Its IUPAC name is 2-N,4-N,6-N-tris[3-(2-ethoxyethoxy)-4-methoxyphenyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-tris[3-(2-ethoxyethoxy)-4-methoxyphenyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 23527673 |
| Molecular Formula | C36H48N6O9 |
| Molecular Weight | 708.81 g/mol |
| Exact Mass | 708.35 |
| IUPAC Name | 2-N,4-N,6-N-tris[3-(2-ethoxyethoxy)-4-methoxyphenyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCOCCOc1cc(Nc2nc(Nc3ccc(OC)c(OCCOCC)c3)nc(Nc3ccc(OC)c(OCCOCC)c3)n2)ccc1OC |
| InChI | InChI=1S/C36H48N6O9/c1-7-46-16-19-49-31-22-25(10-13-28(31)43-4)37-34-40-35(38-26-11-14-29(44-5)32(23-26)50-20-17-47-8-2)42-36(41-34)39-27-12-15-30(45-6)33(24-27)51-21-18-48-9-3/h10-15,22-24H,7-9,16-21H2,1-6H3,(H3,37,38,39,40,41,42) |
| InChIKey | DDQXAGRILVMXHG-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 157.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.81 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|