C20H20ClN3O3S — CID 155586385
benzyl N-[4-(4-amino-3-methylsulfanylphenoxy)-2-pyridinyl]carbamate;hydrochloride (PubChem CID 155586385) has the molecular formula C20H20ClN3O3S and a molecular weight of 417.92 g/mol. Its IUPAC name is benzyl N-[4-(4-amino-3-methylsulfanylphenoxy)-2-pyridinyl]carbamate;hydrochloride.
| Compound Name | benzyl N-[4-(4-amino-3-methylsulfanylphenoxy)-2-pyridinyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 155586385 |
| Molecular Formula | C20H20ClN3O3S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | benzyl N-[4-(4-amino-3-methylsulfanylphenoxy)-2-pyridinyl]carbamate;hydrochloride |
| SMILES | CSc1cc(Oc2ccnc(NC(=O)OCc3ccccc3)c2)ccc1N.Cl |
| InChI | InChI=1S/C20H19N3O3S.ClH/c1-27-18-11-15(7-8-17(18)21)26-16-9-10-22-19(12-16)23-20(24)25-13-14-5-3-2-4-6-14;/h2-12H,13,21H2,1H3,(H,22,23,24);1H |
| InChIKey | WSNXPIHOWGMVPO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|