C13H14ClN3O3S — CID 163210137
[4-(4-amino-3-methylsulfanylphenoxy)-2-pyridinyl]carbamic acid;hydrochloride (PubChem CID 163210137) has the molecular formula C13H14ClN3O3S and a molecular weight of 327.79 g/mol. Its IUPAC name is [4-(4-amino-3-methylsulfanylphenoxy)-2-pyridinyl]carbamic acid;hydrochloride.
| Compound Name | [4-(4-amino-3-methylsulfanylphenoxy)-2-pyridinyl]carbamic acid;hydrochloride |
|---|---|
| PubChem CID | 163210137 |
| Molecular Formula | C13H14ClN3O3S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | [4-(4-amino-3-methylsulfanylphenoxy)-2-pyridinyl]carbamic acid;hydrochloride |
| SMILES | CSc1cc(Oc2ccnc(NC(=O)O)c2)ccc1N.Cl |
| InChI | InChI=1S/C13H13N3O3S.ClH/c1-20-11-6-8(2-3-10(11)14)19-9-4-5-15-12(7-9)16-13(17)18;/h2-7H,14H2,1H3,(H,15,16)(H,17,18);1H |
| InChIKey | LQVWEVUETJVHHI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|