C17H20N4O2 — CID 164899632
1-[4-(4-amino-2,3-dimethylphenoxy)-2-pyridinyl]-3-cyclopropylurea (PubChem CID 164899632) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-[4-(4-amino-2,3-dimethylphenoxy)-2-pyridinyl]-3-cyclopropylurea.
| Compound Name | 1-[4-(4-amino-2,3-dimethylphenoxy)-2-pyridinyl]-3-cyclopropylurea |
|---|---|
| PubChem CID | 164899632 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-[4-(4-amino-2,3-dimethylphenoxy)-2-pyridinyl]-3-cyclopropylurea |
| SMILES | Cc1c(N)ccc(Oc2ccnc(NC(=O)NC3CC3)c2)c1C |
| InChI | InChI=1S/C17H20N4O2/c1-10-11(2)15(6-5-14(10)18)23-13-7-8-19-16(9-13)21-17(22)20-12-3-4-12/h5-9,12H,3-4,18H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | WLCCSDSLHGQSSE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|