C20H8F12N2O2 — CID 18692281
3-[3-(3-amino-2,4-difluorophenoxy)-2,5-difluoro-4,6-bis(trifluoromethyl)phenoxy]-2,6-difluoroaniline (PubChem CID 18692281) has the molecular formula C20H8F12N2O2 and a molecular weight of 536.27 g/mol. Its IUPAC name is 3-[3-(3-amino-2,4-difluorophenoxy)-2,5-difluoro-4,6-bis(trifluoromethyl)phenoxy]-2,6-difluoroaniline.
| Compound Name | 3-[3-(3-amino-2,4-difluorophenoxy)-2,5-difluoro-4,6-bis(trifluoromethyl)phenoxy]-2,6-difluoroaniline |
|---|---|
| PubChem CID | 18692281 |
| Molecular Formula | C20H8F12N2O2 |
| Molecular Weight | 536.27 g/mol |
| Exact Mass | 536.04 |
| IUPAC Name | 3-[3-(3-amino-2,4-difluorophenoxy)-2,5-difluoro-4,6-bis(trifluoromethyl)phenoxy]-2,6-difluoroaniline |
| SMILES | Nc1c(F)ccc(Oc2c(F)c(Oc3ccc(F)c(N)c3F)c(C(F)(F)F)c(F)c2C(F)(F)F)c1F |
| InChI | InChI=1S/C20H8F12N2O2/c21-5-1-3-7(11(23)15(5)33)35-17-9(19(27,28)29)13(25)10(20(30,31)32)18(14(17)26)36-8-4-2-6(22)16(34)12(8)24/h1-4H,33-34H2 |
| InChIKey | IMUXAFDAFSOIBK-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.27 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|