C14H9F6NO — CID 57146351
4-phenoxy-2,3-bis(trifluoromethyl)aniline (PubChem CID 57146351) has the molecular formula C14H9F6NO and a molecular weight of 321.22 g/mol. Its IUPAC name is 4-phenoxy-2,3-bis(trifluoromethyl)aniline.
| Compound Name | 4-phenoxy-2,3-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 57146351 |
| Molecular Formula | C14H9F6NO |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 4-phenoxy-2,3-bis(trifluoromethyl)aniline |
| SMILES | Nc1ccc(Oc2ccccc2)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C14H9F6NO/c15-13(16,17)11-9(21)6-7-10(12(11)14(18,19)20)22-8-4-2-1-3-5-8/h1-7H,21H2 |
| InChIKey | ZROBYNGRZAYHBK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|