About 4-phenoxy-2,3-bis(trifluoromethyl)aniline
4-phenoxy-2,3-bis(trifluoromethyl)aniline (PubChem CID 57146351) has the molecular formula C14H9F6NO
and a molecular weight of 321.22 g/mol. Its IUPAC name is 4-phenoxy-2,3-bis(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | 4-phenoxy-2,3-bis(trifluoromethyl)aniline |
| PubChem CID | 57146351 |
| Molecular Formula | C14H9F6NO |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 4-phenoxy-2,3-bis(trifluoromethyl)aniline |
| SMILES | Nc1ccc(Oc2ccccc2)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C14H9F6NO/c15-13(16,17)11-9(21)6-7-10(12(11)14(18,19)20)22-8-4-2-1-3-5-8/h1-7H,21H2 |
| InChIKey | ZROBYNGRZAYHBK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-phenoxy-2,3-bis(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenoxy-2,3-bis(trifluoromethyl)aniline?
The IUPAC name of 4-phenoxy-2,3-bis(trifluoromethyl)aniline (CID 57146351) is 4-phenoxy-2,3-bis(trifluoromethyl)aniline.
What is the SMILES notation for 4-phenoxy-2,3-bis(trifluoromethyl)aniline?
The canonical SMILES for 4-phenoxy-2,3-bis(trifluoromethyl)aniline is Nc1ccc(Oc2ccccc2)c(C(F)(F)F)c1C(F)(F)F.
What is the InChIKey of 4-phenoxy-2,3-bis(trifluoromethyl)aniline?
The InChIKey is ZROBYNGRZAYHBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F6NO/c15-13(16,17)11-9(21)6-7-10(12(11)14(18,19)20)22-8-4-2-1-3-5-8/h1-7H,21H2.
What are the key properties of 4-phenoxy-2,3-bis(trifluoromethyl)aniline?
4-phenoxy-2,3-bis(trifluoromethyl)aniline has a molecular weight of 321.22 g/mol, XLogP of 5.10, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenoxy-2,3-bis(trifluoromethyl)aniline is sourced from PubChem (CID 57146351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).