C8H4F6IN — CID 119023221
4-iodo-2,3-bis(trifluoromethyl)aniline (PubChem CID 119023221) has the molecular formula C8H4F6IN and a molecular weight of 355.02 g/mol. Its IUPAC name is 4-iodo-2,3-bis(trifluoromethyl)aniline.
| Compound Name | 4-iodo-2,3-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 119023221 |
| Molecular Formula | C8H4F6IN |
| Molecular Weight | 355.02 g/mol |
| Exact Mass | 354.93 |
| IUPAC Name | 4-iodo-2,3-bis(trifluoromethyl)aniline |
| SMILES | Nc1ccc(I)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C8H4F6IN/c9-7(10,11)5-3(15)1-2-4(16)6(5)8(12,13)14/h1-2H,16H2 |
| InChIKey | HXQNLSOXXSMKHS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.02 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|