C8H5ClF2O3 — CID 131460711
(2S)-2-(2-chloro-3,6-difluorophenyl)-2-hydroxyacetic acid (PubChem CID 131460711) has the molecular formula C8H5ClF2O3 and a molecular weight of 222.57 g/mol. Its IUPAC name is (2S)-2-(2-chloro-3,6-difluorophenyl)-2-hydroxyacetic acid.
| Compound Name | (2S)-2-(2-chloro-3,6-difluorophenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 131460711 |
| Molecular Formula | C8H5ClF2O3 |
| Molecular Weight | 222.57 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | (2S)-2-(2-chloro-3,6-difluorophenyl)-2-hydroxyacetic acid |
| SMILES | O=C(O)[C@@H](O)c1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C8H5ClF2O3/c9-6-4(11)2-1-3(10)5(6)7(12)8(13)14/h1-2,7,12H,(H,13,14)/t7-/m0/s1 |
| InChIKey | AHLRROCJCNPAQZ-ZETCQYMHSA-N |
| XLogP | 1.74 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.57 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|