C14H9Cl2FO3 — CID 134633829
2-[2-(3,5-dichlorophenyl)-6-fluorophenyl]-2-hydroxyacetic acid (PubChem CID 134633829) has the molecular formula C14H9Cl2FO3 and a molecular weight of 315.13 g/mol. Its IUPAC name is 2-[2-(3,5-dichlorophenyl)-6-fluorophenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[2-(3,5-dichlorophenyl)-6-fluorophenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 134633829 |
| Molecular Formula | C14H9Cl2FO3 |
| Molecular Weight | 315.13 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 2-[2-(3,5-dichlorophenyl)-6-fluorophenyl]-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1c(F)cccc1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H9Cl2FO3/c15-8-4-7(5-9(16)6-8)10-2-1-3-11(17)12(10)13(18)14(19)20/h1-6,13,18H,(H,19,20) |
| InChIKey | XKPOQNCQHYJRCY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.13 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |