C8H5F3O3 — CID 131599088
(2R)-2-hydroxy-2-(2,4,6-trifluorophenyl)acetic acid (PubChem CID 131599088) has the molecular formula C8H5F3O3 and a molecular weight of 206.12 g/mol. Its IUPAC name is (2R)-2-hydroxy-2-(2,4,6-trifluorophenyl)acetic acid.
| Compound Name | (2R)-2-hydroxy-2-(2,4,6-trifluorophenyl)acetic acid |
|---|---|
| PubChem CID | 131599088 |
| Molecular Formula | C8H5F3O3 |
| Molecular Weight | 206.12 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | (2R)-2-hydroxy-2-(2,4,6-trifluorophenyl)acetic acid |
| SMILES | O=C(O)[C@H](O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C8H5F3O3/c9-3-1-4(10)6(5(11)2-3)7(12)8(13)14/h1-2,7,12H,(H,13,14)/t7-/m1/s1 |
| InChIKey | LJQKKPAHXJZART-SSDOTTSWSA-N |
| XLogP | 1.22 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.12 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |