C9H8F2O3 — CID 119000982
2-(2,3-difluoro-6-methylphenyl)-2-hydroxyacetic acid (PubChem CID 119000982) has the molecular formula C9H8F2O3 and a molecular weight of 202.16 g/mol. Its IUPAC name is 2-(2,3-difluoro-6-methylphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(2,3-difluoro-6-methylphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 119000982 |
| Molecular Formula | C9H8F2O3 |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 2-(2,3-difluoro-6-methylphenyl)-2-hydroxyacetic acid |
| SMILES | Cc1ccc(F)c(F)c1C(O)C(=O)O |
| InChI | InChI=1S/C9H8F2O3/c1-4-2-3-5(10)7(11)6(4)8(12)9(13)14/h2-3,8,12H,1H3,(H,13,14) |
| InChIKey | RIUULBTYGPMPCO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |