C9H5F2NO3 — CID 131601802
2-(6-cyano-2,3-difluorophenyl)-2-hydroxyacetic acid (PubChem CID 131601802) has the molecular formula C9H5F2NO3 and a molecular weight of 213.14 g/mol. Its IUPAC name is 2-(6-cyano-2,3-difluorophenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(6-cyano-2,3-difluorophenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 131601802 |
| Molecular Formula | C9H5F2NO3 |
| Molecular Weight | 213.14 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 2-(6-cyano-2,3-difluorophenyl)-2-hydroxyacetic acid |
| SMILES | N#Cc1ccc(F)c(F)c1C(O)C(=O)O |
| InChI | InChI=1S/C9H5F2NO3/c10-5-2-1-4(3-12)6(7(5)11)8(13)9(14)15/h1-2,8,13H,(H,14,15) |
| InChIKey | WSPKCUAVVYRIKF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.14 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |