C10H7F2NO — CID 89173719
3,4-difluoro-2-(1-oxopropan-2-yl)benzonitrile (PubChem CID 89173719) has the molecular formula C10H7F2NO and a molecular weight of 195.17 g/mol. Its IUPAC name is 3,4-difluoro-2-(1-oxopropan-2-yl)benzonitrile.
| Compound Name | 3,4-difluoro-2-(1-oxopropan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 89173719 |
| Molecular Formula | C10H7F2NO |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 3,4-difluoro-2-(1-oxopropan-2-yl)benzonitrile |
| SMILES | CC(C=O)c1c(C#N)ccc(F)c1F |
| InChI | InChI=1S/C10H7F2NO/c1-6(5-14)9-7(4-13)2-3-8(11)10(9)12/h2-3,5-6H,1H3 |
| InChIKey | PTAQWGPHIGWXQA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|